C15H26Cl2N8 — CID 154902328
6-(3-aminocyclobutyl)-2-N,2-N-dimethyl-4-N-[3-(triazol-1-yl)propyl]pyrimidine-2,4-diamine;dihydrochloride (PubChem CID 154902328) has the molecular formula C15H26Cl2N8 and a molecular weight of 389.34 g/mol. Its IUPAC name is 6-(3-aminocyclobutyl)-2-N,2-N-dimethyl-4-N-[3-(triazol-1-yl)propyl]pyrimidine-2,4-diamine;dihydrochloride.
| Compound Name | 6-(3-aminocyclobutyl)-2-N,2-N-dimethyl-4-N-[3-(triazol-1-yl)propyl]pyrimidine-2,4-diamine;dihydrochloride |
|---|---|
| PubChem CID | 154902328 |
| Molecular Formula | C15H26Cl2N8 |
| Molecular Weight | 389.34 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 6-(3-aminocyclobutyl)-2-N,2-N-dimethyl-4-N-[3-(triazol-1-yl)propyl]pyrimidine-2,4-diamine;dihydrochloride |
| SMILES | CN(C)c1nc(NCCCn2ccnn2)cc(C2CC(N)C2)n1.Cl.Cl |
| InChI | InChI=1S/C15H24N8.2ClH/c1-22(2)15-19-13(11-8-12(16)9-11)10-14(20-15)17-4-3-6-23-7-5-18-21-23;;/h5,7,10-12H,3-4,6,8-9,16H2,1-2H3,(H,17,19,20);2*1H |
| InChIKey | RWRWQQMLMVQTJE-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 97.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.34 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|