C13H26Cl2N4OS — CID 154902774
(2S)-N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-4-methyl-2-(methylamino)pentanamide;dihydrochloride (PubChem CID 154902774) has the molecular formula C13H26Cl2N4OS and a molecular weight of 357.35 g/mol. Its IUPAC name is (2S)-N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-4-methyl-2-(methylamino)pentanamide;dihydrochloride.
| Compound Name | (2S)-N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-4-methyl-2-(methylamino)pentanamide;dihydrochloride |
|---|---|
| PubChem CID | 154902774 |
| Molecular Formula | C13H26Cl2N4OS |
| Molecular Weight | 357.35 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | (2S)-N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-4-methyl-2-(methylamino)pentanamide;dihydrochloride |
| SMILES | CN[C@@H](CC(C)C)C(=O)NCCCc1csc(N)n1.Cl.Cl |
| InChI | InChI=1S/C13H24N4OS.2ClH/c1-9(2)7-11(15-3)12(18)16-6-4-5-10-8-19-13(14)17-10;;/h8-9,11,15H,4-7H2,1-3H3,(H2,14,17)(H,16,18);2*1H/t11-;;/m0../s1 |
| InChIKey | YFMJAGBFWVWYMQ-IDMXKUIJSA-N |
| XLogP | 2.25 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|