C16H28Cl2N2O2 — CID 154903203
[1-[2-(2-methoxy-4-methylphenoxy)ethyl]piperidin-2-yl]methanamine;dihydrochloride (PubChem CID 154903203) has the molecular formula C16H28Cl2N2O2 and a molecular weight of 351.32 g/mol. Its IUPAC name is [1-[2-(2-methoxy-4-methylphenoxy)ethyl]piperidin-2-yl]methanamine;dihydrochloride.
| Compound Name | [1-[2-(2-methoxy-4-methylphenoxy)ethyl]piperidin-2-yl]methanamine;dihydrochloride |
|---|---|
| PubChem CID | 154903203 |
| Molecular Formula | C16H28Cl2N2O2 |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | [1-[2-(2-methoxy-4-methylphenoxy)ethyl]piperidin-2-yl]methanamine;dihydrochloride |
| SMILES | COc1cc(C)ccc1OCCN1CCCCC1CN.Cl.Cl |
| InChI | InChI=1S/C16H26N2O2.2ClH/c1-13-6-7-15(16(11-13)19-2)20-10-9-18-8-4-3-5-14(18)12-17;;/h6-7,11,14H,3-5,8-10,12,17H2,1-2H3;2*1H |
| InChIKey | DYBCYQJVHBJLQY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |