About 5-[[6-(3-aminocyclobutyl)pyrimidin-4-yl]amino]pentan-1-ol;dihydrochloride
5-[[6-(3-aminocyclobutyl)pyrimidin-4-yl]amino]pentan-1-ol;dihydrochloride (PubChem CID 154903330) has the molecular formula C13H24Cl2N4O
and a molecular weight of 323.27 g/mol. Its IUPAC name is 5-[[6-(3-aminocyclobutyl)pyrimidin-4-yl]amino]pentan-1-ol;dihydrochloride.
Molecular Properties
| Compound Name | 5-[[6-(3-aminocyclobutyl)pyrimidin-4-yl]amino]pentan-1-ol;dihydrochloride |
| PubChem CID | 154903330 |
| Molecular Formula | C13H24Cl2N4O |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 5-[[6-(3-aminocyclobutyl)pyrimidin-4-yl]amino]pentan-1-ol;dihydrochloride |
| SMILES | Cl.Cl.NC1CC(c2cc(NCCCCCO)ncn2)C1 |
| InChI | InChI=1S/C13H22N4O.2ClH/c14-11-6-10(7-11)12-8-13(17-9-16-12)15-4-2-1-3-5-18;;/h8-11,18H,1-7,14H2,(H,15,16,17);2*1H |
| InChIKey | PMUMTMWIMNRLFK-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[[6-(3-aminocyclobutyl)pyrimidin-4-yl]amino]pentan-1-ol;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[6-(3-aminocyclobutyl)pyrimidin-4-yl]amino]pentan-1-ol;dihydrochloride?
The IUPAC name of 5-[[6-(3-aminocyclobutyl)pyrimidin-4-yl]amino]pentan-1-ol;dihydrochloride (CID 154903330) is 5-[[6-(3-aminocyclobutyl)pyrimidin-4-yl]amino]pentan-1-ol;dihydrochloride.
What is the SMILES notation for 5-[[6-(3-aminocyclobutyl)pyrimidin-4-yl]amino]pentan-1-ol;dihydrochloride?
The canonical SMILES for 5-[[6-(3-aminocyclobutyl)pyrimidin-4-yl]amino]pentan-1-ol;dihydrochloride is Cl.Cl.NC1CC(c2cc(NCCCCCO)ncn2)C1.
What is the InChIKey of 5-[[6-(3-aminocyclobutyl)pyrimidin-4-yl]amino]pentan-1-ol;dihydrochloride?
The InChIKey is PMUMTMWIMNRLFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N4O.2ClH/c14-11-6-10(7-11)12-8-13(17-9-16-12)15-4-2-1-3-5-18;;/h8-11,18H,1-7,14H2,(H,15,16,17);2*1H.
What are the key properties of 5-[[6-(3-aminocyclobutyl)pyrimidin-4-yl]amino]pentan-1-ol;dihydrochloride?
5-[[6-(3-aminocyclobutyl)pyrimidin-4-yl]amino]pentan-1-ol;dihydrochloride has a molecular weight of 323.27 g/mol, XLogP of 2.10, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[6-(3-aminocyclobutyl)pyrimidin-4-yl]amino]pentan-1-ol;dihydrochloride is sourced from PubChem (CID 154903330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).