C22H31ClN4O — CID 154903726
1-(4-benzylpiperidin-1-yl)-2-(5-piperidin-3-ylpyrazol-1-yl)ethanone;hydrochloride (PubChem CID 154903726) has the molecular formula C22H31ClN4O and a molecular weight of 402.97 g/mol. Its IUPAC name is 1-(4-benzylpiperidin-1-yl)-2-(5-piperidin-3-ylpyrazol-1-yl)ethanone;hydrochloride.
| Compound Name | 1-(4-benzylpiperidin-1-yl)-2-(5-piperidin-3-ylpyrazol-1-yl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 154903726 |
| Molecular Formula | C22H31ClN4O |
| Molecular Weight | 402.97 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 1-(4-benzylpiperidin-1-yl)-2-(5-piperidin-3-ylpyrazol-1-yl)ethanone;hydrochloride |
| SMILES | Cl.O=C(Cn1nccc1C1CCCNC1)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H30N4O.ClH/c27-22(17-26-21(8-12-24-26)20-7-4-11-23-16-20)25-13-9-19(10-14-25)15-18-5-2-1-3-6-18;/h1-3,5-6,8,12,19-20,23H,4,7,9-11,13-17H2;1H |
| InChIKey | NQDRJZXBVNMBQW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.97 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |