C16H28N2O6 — CID 154904035
4-ethyl-1-[2-(3-hydroxypiperidin-1-yl)acetyl]piperidine-4-carboxylic acid;formic acid (PubChem CID 154904035) has the molecular formula C16H28N2O6 and a molecular weight of 344.41 g/mol. Its IUPAC name is 4-ethyl-1-[2-(3-hydroxypiperidin-1-yl)acetyl]piperidine-4-carboxylic acid;formic acid.
| Compound Name | 4-ethyl-1-[2-(3-hydroxypiperidin-1-yl)acetyl]piperidine-4-carboxylic acid;formic acid |
|---|---|
| PubChem CID | 154904035 |
| Molecular Formula | C16H28N2O6 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | 4-ethyl-1-[2-(3-hydroxypiperidin-1-yl)acetyl]piperidine-4-carboxylic acid;formic acid |
| SMILES | CCC1(C(=O)O)CCN(C(=O)CN2CCCC(O)C2)CC1.O=CO |
| InChI | InChI=1S/C15H26N2O4.CH2O2/c1-2-15(14(20)21)5-8-17(9-6-15)13(19)11-16-7-3-4-12(18)10-16;2-1-3/h12,18H,2-11H2,1H3,(H,20,21);1H,(H,2,3) |
| InChIKey | ONASYZPRIRVVMR-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 118.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|