C19H27F4N3O3 — CID 154904433
1-[2-(azepan-1-yl)ethyl]-3-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]-1-methylurea;formic acid (PubChem CID 154904433) has the molecular formula C19H27F4N3O3 and a molecular weight of 421.44 g/mol. Its IUPAC name is 1-[2-(azepan-1-yl)ethyl]-3-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]-1-methylurea;formic acid.
| Compound Name | 1-[2-(azepan-1-yl)ethyl]-3-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]-1-methylurea;formic acid |
|---|---|
| PubChem CID | 154904433 |
| Molecular Formula | C19H27F4N3O3 |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 1-[2-(azepan-1-yl)ethyl]-3-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]-1-methylurea;formic acid |
| SMILES | CN(CCN1CCCCCC1)C(=O)NCc1ccc(C(F)(F)F)cc1F.O=CO |
| InChI | InChI=1S/C18H25F4N3O.CH2O2/c1-24(10-11-25-8-4-2-3-5-9-25)17(26)23-13-14-6-7-15(12-16(14)19)18(20,21)22;2-1-3/h6-7,12H,2-5,8-11,13H2,1H3,(H,23,26);1H,(H,2,3) |
| InChIKey | PUEGPIATSMBDBO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|