C24Br6F12 — CID 15490458
1,3,5-tris(3,5-dibromo-2,4,6-trifluorophenyl)-2,4,6-trifluorobenzene (PubChem CID 15490458) has the molecular formula C24Br6F12 and a molecular weight of 995.66 g/mol. Its IUPAC name is 1,3,5-tris(3,5-dibromo-2,4,6-trifluorophenyl)-2,4,6-trifluorobenzene.
| Compound Name | 1,3,5-tris(3,5-dibromo-2,4,6-trifluorophenyl)-2,4,6-trifluorobenzene |
|---|---|
| PubChem CID | 15490458 |
| Molecular Formula | C24Br6F12 |
| Molecular Weight | 995.66 g/mol |
| Exact Mass | 989.49 |
| IUPAC Name | 1,3,5-tris(3,5-dibromo-2,4,6-trifluorophenyl)-2,4,6-trifluorobenzene |
| SMILES | Fc1c(Br)c(F)c(-c2c(F)c(-c3c(F)c(Br)c(F)c(Br)c3F)c(F)c(-c3c(F)c(Br)c(F)c(Br)c3F)c2F)c(F)c1Br |
| InChI | InChI=1S/C24Br6F12/c25-7-16(34)4(17(35)8(26)22(7)40)1-13(31)2(5-18(36)9(27)23(41)10(28)19(5)37)15(33)3(14(1)32)6-20(38)11(29)24(42)12(30)21(6)39 |
| InChIKey | JFQHCKDOHWFDBP-UHFFFAOYSA-N |
| XLogP | 12.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 995.66 |
| LogP ≤ 5 | 12.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|