C35H34F3NO8 — CID 15490467
N-phenylmethoxy-2-[[4-[3-(trifluoromethyl)phenyl]-2,6,13,16,19-pentaoxatricyclo[18.4.0.07,12]tetracosa-1(24),7,9,11,20,22-hexaen-4-yl]oxy]acetamide (PubChem CID 15490467) has the molecular formula C35H34F3NO8 and a molecular weight of 653.65 g/mol. Its IUPAC name is N-phenylmethoxy-2-[[4-[3-(trifluoromethyl)phenyl]-2,6,13,16,19-pentaoxatricyclo[18.4.0.07,12]tetracosa-1(24),7,9,11,20,22-hexaen-4-yl]oxy]acetamide.
| Compound Name | N-phenylmethoxy-2-[[4-[3-(trifluoromethyl)phenyl]-2,6,13,16,19-pentaoxatricyclo[18.4.0.07,12]tetracosa-1(24),7,9,11,20,22-hexaen-4-yl]oxy]acetamide |
|---|---|
| PubChem CID | 15490467 |
| Molecular Formula | C35H34F3NO8 |
| Molecular Weight | 653.65 g/mol |
| Exact Mass | 653.22 |
| IUPAC Name | N-phenylmethoxy-2-[[4-[3-(trifluoromethyl)phenyl]-2,6,13,16,19-pentaoxatricyclo[18.4.0.07,12]tetracosa-1(24),7,9,11,20,22-hexaen-4-yl]oxy]acetamide |
| SMILES | O=C(COC1(c2cccc(C(F)(F)F)c2)COc2ccccc2OCCOCCOc2ccccc2OC1)NOCc1ccccc1 |
| InChI | InChI=1S/C35H34F3NO8/c36-35(37,38)28-12-8-11-27(21-28)34(46-23-33(40)39-47-22-26-9-2-1-3-10-26)24-44-31-15-6-4-13-29(31)42-19-17-41-18-20-43-30-14-5-7-16-32(30)45-25-34/h1-16,21H,17-20,22-25H2,(H,39,40) |
| InChIKey | WVNDTCFFLWYMDC-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.65 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|