C36H33F6NO8 — CID 15490471
2-[[4-[3,5-bis(trifluoromethyl)phenyl]-2,6,13,16,19-pentaoxatricyclo[18.4.0.07,12]tetracosa-1(24),7,9,11,20,22-hexaen-4-yl]oxy]-N-phenylmethoxyacetamide (PubChem CID 15490471) has the molecular formula C36H33F6NO8 and a molecular weight of 721.65 g/mol. Its IUPAC name is 2-[[4-[3,5-bis(trifluoromethyl)phenyl]-2,6,13,16,19-pentaoxatricyclo[18.4.0.07,12]tetracosa-1(24),7,9,11,20,22-hexaen-4-yl]oxy]-N-phenylmethoxyacetamide.
| Compound Name | 2-[[4-[3,5-bis(trifluoromethyl)phenyl]-2,6,13,16,19-pentaoxatricyclo[18.4.0.07,12]tetracosa-1(24),7,9,11,20,22-hexaen-4-yl]oxy]-N-phenylmethoxyacetamide |
|---|---|
| PubChem CID | 15490471 |
| Molecular Formula | C36H33F6NO8 |
| Molecular Weight | 721.65 g/mol |
| Exact Mass | 721.21 |
| IUPAC Name | 2-[[4-[3,5-bis(trifluoromethyl)phenyl]-2,6,13,16,19-pentaoxatricyclo[18.4.0.07,12]tetracosa-1(24),7,9,11,20,22-hexaen-4-yl]oxy]-N-phenylmethoxyacetamide |
| SMILES | O=C(COC1(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)COc2ccccc2OCCOCCOc2ccccc2OC1)NOCc1ccccc1 |
| InChI | InChI=1S/C36H33F6NO8/c37-35(38,39)27-18-26(19-28(20-27)36(40,41)42)34(50-22-33(44)43-51-21-25-8-2-1-3-9-25)23-48-31-12-6-4-10-29(31)46-16-14-45-15-17-47-30-11-5-7-13-32(30)49-24-34/h1-13,18-20H,14-17,21-24H2,(H,43,44) |
| InChIKey | CJNRSXJPTXYTRO-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.65 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|