C29H27F6NO8 — CID 15490472
2-[[4-[3,5-bis(trifluoromethyl)phenyl]-2,6,13,16,19-pentaoxatricyclo[18.4.0.07,12]tetracosa-1(24),7,9,11,20,22-hexaen-4-yl]oxy]-N-hydroxyacetamide (PubChem CID 15490472) has the molecular formula C29H27F6NO8 and a molecular weight of 631.52 g/mol. Its IUPAC name is 2-[[4-[3,5-bis(trifluoromethyl)phenyl]-2,6,13,16,19-pentaoxatricyclo[18.4.0.07,12]tetracosa-1(24),7,9,11,20,22-hexaen-4-yl]oxy]-N-hydroxyacetamide.
| Compound Name | 2-[[4-[3,5-bis(trifluoromethyl)phenyl]-2,6,13,16,19-pentaoxatricyclo[18.4.0.07,12]tetracosa-1(24),7,9,11,20,22-hexaen-4-yl]oxy]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 15490472 |
| Molecular Formula | C29H27F6NO8 |
| Molecular Weight | 631.52 g/mol |
| Exact Mass | 631.16 |
| IUPAC Name | 2-[[4-[3,5-bis(trifluoromethyl)phenyl]-2,6,13,16,19-pentaoxatricyclo[18.4.0.07,12]tetracosa-1(24),7,9,11,20,22-hexaen-4-yl]oxy]-N-hydroxyacetamide |
| SMILES | O=C(COC1(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)COc2ccccc2OCCOCCOc2ccccc2OC1)NO |
| InChI | InChI=1S/C29H27F6NO8/c30-28(31,32)20-13-19(14-21(15-20)29(33,34)35)27(44-16-26(37)36-38)17-42-24-7-3-1-5-22(24)40-11-9-39-10-12-41-23-6-2-4-8-25(23)43-18-27/h1-8,13-15,38H,9-12,16-18H2,(H,36,37) |
| InChIKey | PPRUZCJMAGGBJU-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 104.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.52 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|