C19H29ClN4OS — CID 154905007
N-butyl-2-(5-piperidin-3-ylpyrazol-1-yl)-N-(thiophen-3-ylmethyl)acetamide;hydrochloride (PubChem CID 154905007) has the molecular formula C19H29ClN4OS and a molecular weight of 396.99 g/mol. Its IUPAC name is N-butyl-2-(5-piperidin-3-ylpyrazol-1-yl)-N-(thiophen-3-ylmethyl)acetamide;hydrochloride.
| Compound Name | N-butyl-2-(5-piperidin-3-ylpyrazol-1-yl)-N-(thiophen-3-ylmethyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 154905007 |
| Molecular Formula | C19H29ClN4OS |
| Molecular Weight | 396.99 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | N-butyl-2-(5-piperidin-3-ylpyrazol-1-yl)-N-(thiophen-3-ylmethyl)acetamide;hydrochloride |
| SMILES | CCCCN(Cc1ccsc1)C(=O)Cn1nccc1C1CCCNC1.Cl |
| InChI | InChI=1S/C19H28N4OS.ClH/c1-2-3-10-22(13-16-7-11-25-15-16)19(24)14-23-18(6-9-21-23)17-5-4-8-20-12-17;/h6-7,9,11,15,17,20H,2-5,8,10,12-14H2,1H3;1H |
| InChIKey | DRVFPHQJRNMFHR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.99 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |