C18H26N4O5 — CID 154905248
3-[(dimethylamino)methyl]-N-[1-(5-methyl-1H-imidazol-2-yl)ethyl]benzamide;formic acid (PubChem CID 154905248) has the molecular formula C18H26N4O5 and a molecular weight of 378.43 g/mol. Its IUPAC name is 3-[(dimethylamino)methyl]-N-[1-(5-methyl-1H-imidazol-2-yl)ethyl]benzamide;formic acid.
| Compound Name | 3-[(dimethylamino)methyl]-N-[1-(5-methyl-1H-imidazol-2-yl)ethyl]benzamide;formic acid |
|---|---|
| PubChem CID | 154905248 |
| Molecular Formula | C18H26N4O5 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 3-[(dimethylamino)methyl]-N-[1-(5-methyl-1H-imidazol-2-yl)ethyl]benzamide;formic acid |
| SMILES | Cc1cnc(C(C)NC(=O)c2cccc(CN(C)C)c2)[nH]1.O=CO.O=CO |
| InChI | InChI=1S/C16H22N4O.2CH2O2/c1-11-9-17-15(18-11)12(2)19-16(21)14-7-5-6-13(8-14)10-20(3)4;2*2-1-3/h5-9,12H,10H2,1-4H3,(H,17,18)(H,19,21);2*1H,(H,2,3) |
| InChIKey | CEZHYSPWSHTGKX-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 135.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|