C11H17Cl3N2S — CID 154905300
(3aS,6aS)-1-[(3-chlorothiophen-2-yl)methyl]-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole;dihydrochloride (PubChem CID 154905300) has the molecular formula C11H17Cl3N2S and a molecular weight of 315.70 g/mol. Its IUPAC name is (3aS,6aS)-1-[(3-chlorothiophen-2-yl)methyl]-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole;dihydrochloride.
| Compound Name | (3aS,6aS)-1-[(3-chlorothiophen-2-yl)methyl]-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole;dihydrochloride |
|---|---|
| PubChem CID | 154905300 |
| Molecular Formula | C11H17Cl3N2S |
| Molecular Weight | 315.70 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | (3aS,6aS)-1-[(3-chlorothiophen-2-yl)methyl]-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole;dihydrochloride |
| SMILES | Cl.Cl.Clc1ccsc1CN1CC[C@H]2CNC[C@H]21 |
| InChI | InChI=1S/C11H15ClN2S.2ClH/c12-9-2-4-15-11(9)7-14-3-1-8-5-13-6-10(8)14;;/h2,4,8,10,13H,1,3,5-7H2;2*1H/t8-,10+;;/m0../s1 |
| InChIKey | OXUCPTHFTNSFRZ-UQZKZZBYSA-N |
| XLogP | 3.04 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.70 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |