C16H21Cl2N3O — CID 154906466
(4aS,7aS)-6-(isoquinolin-5-ylmethyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine;dihydrochloride (PubChem CID 154906466) has the molecular formula C16H21Cl2N3O and a molecular weight of 342.27 g/mol. Its IUPAC name is (4aS,7aS)-6-(isoquinolin-5-ylmethyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine;dihydrochloride.
| Compound Name | (4aS,7aS)-6-(isoquinolin-5-ylmethyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine;dihydrochloride |
|---|---|
| PubChem CID | 154906466 |
| Molecular Formula | C16H21Cl2N3O |
| Molecular Weight | 342.27 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | (4aS,7aS)-6-(isoquinolin-5-ylmethyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine;dihydrochloride |
| SMILES | Cl.Cl.c1cc(CN2C[C@@H]3NCCO[C@H]3C2)c2ccncc2c1 |
| InChI | InChI=1S/C16H19N3O.2ClH/c1-2-12-8-17-5-4-14(12)13(3-1)9-19-10-15-16(11-19)20-7-6-18-15;;/h1-5,8,15-16,18H,6-7,9-11H2;2*1H/t15-,16-;;/m0../s1 |
| InChIKey | JGOQEJHIMFDNFE-SXBSVMRRSA-N |
| XLogP | 2.25 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |