C12H21N5O3S — CID 154906804
N-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-2-pyrrolidin-1-ylbutanamide;formic acid (PubChem CID 154906804) has the molecular formula C12H21N5O3S and a molecular weight of 315.40 g/mol. Its IUPAC name is N-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-2-pyrrolidin-1-ylbutanamide;formic acid.
| Compound Name | N-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-2-pyrrolidin-1-ylbutanamide;formic acid |
|---|---|
| PubChem CID | 154906804 |
| Molecular Formula | C12H21N5O3S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | N-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-2-pyrrolidin-1-ylbutanamide;formic acid |
| SMILES | CCC(C(=O)NCc1nnc(N)s1)N1CCCC1.O=CO |
| InChI | InChI=1S/C11H19N5OS.CH2O2/c1-2-8(16-5-3-4-6-16)10(17)13-7-9-14-15-11(12)18-9;2-1-3/h8H,2-7H2,1H3,(H2,12,15)(H,13,17);1H,(H,2,3) |
| InChIKey | PXQQUPHANIVNCU-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|