C14H25Cl2N3O — CID 154906908
5-[[(1R,2S,6R,7S)-4,10-diazatricyclo[5.2.1.02,6]decan-10-yl]methyl]-3-ethyl-4,5-dihydro-1,2-oxazole;dihydrochloride (PubChem CID 154906908) has the molecular formula C14H25Cl2N3O and a molecular weight of 322.28 g/mol. Its IUPAC name is 5-[[(1R,2S,6R,7S)-4,10-diazatricyclo[5.2.1.02,6]decan-10-yl]methyl]-3-ethyl-4,5-dihydro-1,2-oxazole;dihydrochloride.
| Compound Name | 5-[[(1R,2S,6R,7S)-4,10-diazatricyclo[5.2.1.02,6]decan-10-yl]methyl]-3-ethyl-4,5-dihydro-1,2-oxazole;dihydrochloride |
|---|---|
| PubChem CID | 154906908 |
| Molecular Formula | C14H25Cl2N3O |
| Molecular Weight | 322.28 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 5-[[(1R,2S,6R,7S)-4,10-diazatricyclo[5.2.1.02,6]decan-10-yl]methyl]-3-ethyl-4,5-dihydro-1,2-oxazole;dihydrochloride |
| SMILES | CCC1=NOC(CN2[C@@H]3CC[C@H]2[C@H]2CNC[C@H]23)C1.Cl.Cl |
| InChI | InChI=1S/C14H23N3O.2ClH/c1-2-9-5-10(18-16-9)8-17-13-3-4-14(17)12-7-15-6-11(12)13;;/h10-15H,2-8H2,1H3;2*1H/t10?,11-,12+,13-,14+;; |
| InChIKey | DPFONJOYYRZDFJ-PYFZIRPNSA-N |
| XLogP | 2.07 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.28 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |