C18H23ClN2OS — CID 154906937
(4-aminoazepan-1-yl)-[3-(3-methylthiophen-2-yl)phenyl]methanone;hydrochloride (PubChem CID 154906937) has the molecular formula C18H23ClN2OS and a molecular weight of 350.92 g/mol. Its IUPAC name is (4-aminoazepan-1-yl)-[3-(3-methylthiophen-2-yl)phenyl]methanone;hydrochloride.
| Compound Name | (4-aminoazepan-1-yl)-[3-(3-methylthiophen-2-yl)phenyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 154906937 |
| Molecular Formula | C18H23ClN2OS |
| Molecular Weight | 350.92 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | (4-aminoazepan-1-yl)-[3-(3-methylthiophen-2-yl)phenyl]methanone;hydrochloride |
| SMILES | Cc1ccsc1-c1cccc(C(=O)N2CCCC(N)CC2)c1.Cl |
| InChI | InChI=1S/C18H22N2OS.ClH/c1-13-8-11-22-17(13)14-4-2-5-15(12-14)18(21)20-9-3-6-16(19)7-10-20;/h2,4-5,8,11-12,16H,3,6-7,9-10,19H2,1H3;1H |
| InChIKey | JKVNFOOOQWVFTD-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.92 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |