C20H37N3O5S — CID 154907331
3-[(1,1-dioxothiolan-3-yl)-methylamino]-N-[(1-piperidin-1-ylcyclopentyl)methyl]propanamide;formic acid (PubChem CID 154907331) has the molecular formula C20H37N3O5S and a molecular weight of 431.60 g/mol. Its IUPAC name is 3-[(1,1-dioxothiolan-3-yl)-methylamino]-N-[(1-piperidin-1-ylcyclopentyl)methyl]propanamide;formic acid.
| Compound Name | 3-[(1,1-dioxothiolan-3-yl)-methylamino]-N-[(1-piperidin-1-ylcyclopentyl)methyl]propanamide;formic acid |
|---|---|
| PubChem CID | 154907331 |
| Molecular Formula | C20H37N3O5S |
| Molecular Weight | 431.60 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | 3-[(1,1-dioxothiolan-3-yl)-methylamino]-N-[(1-piperidin-1-ylcyclopentyl)methyl]propanamide;formic acid |
| SMILES | CN(CCC(=O)NCC1(N2CCCCC2)CCCC1)C1CCS(=O)(=O)C1.O=CO |
| InChI | InChI=1S/C19H35N3O3S.CH2O2/c1-21(17-8-14-26(24,25)15-17)13-7-18(23)20-16-19(9-3-4-10-19)22-11-5-2-6-12-22;2-1-3/h17H,2-16H2,1H3,(H,20,23);1H,(H,2,3) |
| InChIKey | NNZUBMZVTFIWDQ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.60 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|