About acetic acid;N-[(3S,4R)-4-hydroxypiperidin-3-yl]-1-(4-methylphenyl)cyclopropane-1-carboxamide
acetic acid;N-[(3S,4R)-4-hydroxypiperidin-3-yl]-1-(4-methylphenyl)cyclopropane-1-carboxamide (PubChem CID 154908138) has the molecular formula C18H26N2O4
and a molecular weight of 334.42 g/mol. Its IUPAC name is acetic acid;N-[(3S,4R)-4-hydroxypiperidin-3-yl]-1-(4-methylphenyl)cyclopropane-1-carboxamide.
Molecular Properties
| Compound Name | acetic acid;N-[(3S,4R)-4-hydroxypiperidin-3-yl]-1-(4-methylphenyl)cyclopropane-1-carboxamide |
| PubChem CID | 154908138 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | acetic acid;N-[(3S,4R)-4-hydroxypiperidin-3-yl]-1-(4-methylphenyl)cyclopropane-1-carboxamide |
| SMILES | CC(=O)O.Cc1ccc(C2(C(=O)N[C@H]3CNCC[C@H]3O)CC2)cc1 |
| InChI | InChI=1S/C16H22N2O2.C2H4O2/c1-11-2-4-12(5-3-11)16(7-8-16)15(20)18-13-10-17-9-6-14(13)19;1-2(3)4/h2-5,13-14,17,19H,6-10H2,1H3,(H,18,20);1H3,(H,3,4)/t13-,14+;/m0./s1 |
| InChIKey | CXKGIPPZCYJEBY-LMRHVHIWSA-N |
| XLogP | 0.96 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze acetic acid;N-[(3S,4R)-4-hydroxypiperidin-3-yl]-1-(4-methylphenyl)cyclopropane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;N-[(3S,4R)-4-hydroxypiperidin-3-yl]-1-(4-methylphenyl)cyclopropane-1-carboxamide?
The IUPAC name of acetic acid;N-[(3S,4R)-4-hydroxypiperidin-3-yl]-1-(4-methylphenyl)cyclopropane-1-carboxamide (CID 154908138) is acetic acid;N-[(3S,4R)-4-hydroxypiperidin-3-yl]-1-(4-methylphenyl)cyclopropane-1-carboxamide.
What is the SMILES notation for acetic acid;N-[(3S,4R)-4-hydroxypiperidin-3-yl]-1-(4-methylphenyl)cyclopropane-1-carboxamide?
The canonical SMILES for acetic acid;N-[(3S,4R)-4-hydroxypiperidin-3-yl]-1-(4-methylphenyl)cyclopropane-1-carboxamide is CC(=O)O.Cc1ccc(C2(C(=O)N[C@H]3CNCC[C@H]3O)CC2)cc1.
What is the InChIKey of acetic acid;N-[(3S,4R)-4-hydroxypiperidin-3-yl]-1-(4-methylphenyl)cyclopropane-1-carboxamide?
The InChIKey is CXKGIPPZCYJEBY-LMRHVHIWSA-N. The full InChI is InChI=1S/C16H22N2O2.C2H4O2/c1-11-2-4-12(5-3-11)16(7-8-16)15(20)18-13-10-17-9-6-14(13)19;1-2(3)4/h2-5,13-14,17,19H,6-10H2,1H3,(H,18,20);1H3,(H,3,4)/t13-,14+;/m0./s1.
What are the key properties of acetic acid;N-[(3S,4R)-4-hydroxypiperidin-3-yl]-1-(4-methylphenyl)cyclopropane-1-carboxamide?
acetic acid;N-[(3S,4R)-4-hydroxypiperidin-3-yl]-1-(4-methylphenyl)cyclopropane-1-carboxamide has a molecular weight of 334.42 g/mol, XLogP of 0.96, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;N-[(3S,4R)-4-hydroxypiperidin-3-yl]-1-(4-methylphenyl)cyclopropane-1-carboxamide is sourced from PubChem (CID 154908138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).