About 2-(2,8-diazaspiro[4.5]decan-2-ylmethyl)-5-methoxypyran-4-one;dihydrochloride
2-(2,8-diazaspiro[4.5]decan-2-ylmethyl)-5-methoxypyran-4-one;dihydrochloride (PubChem CID 154908349) has the molecular formula C15H24Cl2N2O3
and a molecular weight of 351.27 g/mol. Its IUPAC name is 2-(2,8-diazaspiro[4.5]decan-2-ylmethyl)-5-methoxypyran-4-one;dihydrochloride.
Molecular Properties
| Compound Name | 2-(2,8-diazaspiro[4.5]decan-2-ylmethyl)-5-methoxypyran-4-one;dihydrochloride |
| PubChem CID | 154908349 |
| Molecular Formula | C15H24Cl2N2O3 |
| Molecular Weight | 351.27 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 2-(2,8-diazaspiro[4.5]decan-2-ylmethyl)-5-methoxypyran-4-one;dihydrochloride |
| SMILES | COc1coc(CN2CCC3(CCNCC3)C2)cc1=O.Cl.Cl |
| InChI | InChI=1S/C15H22N2O3.2ClH/c1-19-14-10-20-12(8-13(14)18)9-17-7-4-15(11-17)2-5-16-6-3-15;;/h8,10,16H,2-7,9,11H2,1H3;2*1H |
| InChIKey | UKOMSPDXBPCFFJ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2,8-diazaspiro[4.5]decan-2-ylmethyl)-5-methoxypyran-4-one;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,8-diazaspiro[4.5]decan-2-ylmethyl)-5-methoxypyran-4-one;dihydrochloride?
The IUPAC name of 2-(2,8-diazaspiro[4.5]decan-2-ylmethyl)-5-methoxypyran-4-one;dihydrochloride (CID 154908349) is 2-(2,8-diazaspiro[4.5]decan-2-ylmethyl)-5-methoxypyran-4-one;dihydrochloride.
What is the SMILES notation for 2-(2,8-diazaspiro[4.5]decan-2-ylmethyl)-5-methoxypyran-4-one;dihydrochloride?
The canonical SMILES for 2-(2,8-diazaspiro[4.5]decan-2-ylmethyl)-5-methoxypyran-4-one;dihydrochloride is COc1coc(CN2CCC3(CCNCC3)C2)cc1=O.Cl.Cl.
What is the InChIKey of 2-(2,8-diazaspiro[4.5]decan-2-ylmethyl)-5-methoxypyran-4-one;dihydrochloride?
The InChIKey is UKOMSPDXBPCFFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O3.2ClH/c1-19-14-10-20-12(8-13(14)18)9-17-7-4-15(11-17)2-5-16-6-3-15;;/h8,10,16H,2-7,9,11H2,1H3;2*1H.
What are the key properties of 2-(2,8-diazaspiro[4.5]decan-2-ylmethyl)-5-methoxypyran-4-one;dihydrochloride?
2-(2,8-diazaspiro[4.5]decan-2-ylmethyl)-5-methoxypyran-4-one;dihydrochloride has a molecular weight of 351.27 g/mol, XLogP of 2.07, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,8-diazaspiro[4.5]decan-2-ylmethyl)-5-methoxypyran-4-one;dihydrochloride is sourced from PubChem (CID 154908349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).