About (1,4-dimethylpiperidin-4-yl)-[4-(2-methylsulfanylethyl)piperazin-1-yl]methanone;formic acid
(1,4-dimethylpiperidin-4-yl)-[4-(2-methylsulfanylethyl)piperazin-1-yl]methanone;formic acid (PubChem CID 154908641) has the molecular formula C16H31N3O3S
and a molecular weight of 345.51 g/mol. Its IUPAC name is (1,4-dimethylpiperidin-4-yl)-[4-(2-methylsulfanylethyl)piperazin-1-yl]methanone;formic acid.
Molecular Properties
| Compound Name | (1,4-dimethylpiperidin-4-yl)-[4-(2-methylsulfanylethyl)piperazin-1-yl]methanone;formic acid |
| PubChem CID | 154908641 |
| Molecular Formula | C16H31N3O3S |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | (1,4-dimethylpiperidin-4-yl)-[4-(2-methylsulfanylethyl)piperazin-1-yl]methanone;formic acid |
| SMILES | CSCCN1CCN(C(=O)C2(C)CCN(C)CC2)CC1.O=CO |
| InChI | InChI=1S/C15H29N3OS.CH2O2/c1-15(4-6-16(2)7-5-15)14(19)18-10-8-17(9-11-18)12-13-20-3;2-1-3/h4-13H2,1-3H3;1H,(H,2,3) |
| InChIKey | BFXKNBIYSJEVTA-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (1,4-dimethylpiperidin-4-yl)-[4-(2-methylsulfanylethyl)piperazin-1-yl]methanone;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,4-dimethylpiperidin-4-yl)-[4-(2-methylsulfanylethyl)piperazin-1-yl]methanone;formic acid?
The IUPAC name of (1,4-dimethylpiperidin-4-yl)-[4-(2-methylsulfanylethyl)piperazin-1-yl]methanone;formic acid (CID 154908641) is (1,4-dimethylpiperidin-4-yl)-[4-(2-methylsulfanylethyl)piperazin-1-yl]methanone;formic acid.
What is the SMILES notation for (1,4-dimethylpiperidin-4-yl)-[4-(2-methylsulfanylethyl)piperazin-1-yl]methanone;formic acid?
The canonical SMILES for (1,4-dimethylpiperidin-4-yl)-[4-(2-methylsulfanylethyl)piperazin-1-yl]methanone;formic acid is CSCCN1CCN(C(=O)C2(C)CCN(C)CC2)CC1.O=CO.
What is the InChIKey of (1,4-dimethylpiperidin-4-yl)-[4-(2-methylsulfanylethyl)piperazin-1-yl]methanone;formic acid?
The InChIKey is BFXKNBIYSJEVTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29N3OS.CH2O2/c1-15(4-6-16(2)7-5-15)14(19)18-10-8-17(9-11-18)12-13-20-3;2-1-3/h4-13H2,1-3H3;1H,(H,2,3).
What are the key properties of (1,4-dimethylpiperidin-4-yl)-[4-(2-methylsulfanylethyl)piperazin-1-yl]methanone;formic acid?
(1,4-dimethylpiperidin-4-yl)-[4-(2-methylsulfanylethyl)piperazin-1-yl]methanone;formic acid has a molecular weight of 345.51 g/mol, XLogP of 0.93, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1,4-dimethylpiperidin-4-yl)-[4-(2-methylsulfanylethyl)piperazin-1-yl]methanone;formic acid is sourced from PubChem (CID 154908641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).