About 5,8-dichloro-3-[(1-methylpyrrolidin-3-yl)methyl]quinazolin-4-one;formic acid
5,8-dichloro-3-[(1-methylpyrrolidin-3-yl)methyl]quinazolin-4-one;formic acid (PubChem CID 154908704) has the molecular formula C15H17Cl2N3O3
and a molecular weight of 358.23 g/mol. Its IUPAC name is 5,8-dichloro-3-[(1-methylpyrrolidin-3-yl)methyl]quinazolin-4-one;formic acid.
Molecular Properties
| Compound Name | 5,8-dichloro-3-[(1-methylpyrrolidin-3-yl)methyl]quinazolin-4-one;formic acid |
| PubChem CID | 154908704 |
| Molecular Formula | C15H17Cl2N3O3 |
| Molecular Weight | 358.23 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 5,8-dichloro-3-[(1-methylpyrrolidin-3-yl)methyl]quinazolin-4-one;formic acid |
| SMILES | CN1CCC(Cn2cnc3c(Cl)ccc(Cl)c3c2=O)C1.O=CO |
| InChI | InChI=1S/C14H15Cl2N3O.CH2O2/c1-18-5-4-9(6-18)7-19-8-17-13-11(16)3-2-10(15)12(13)14(19)20;2-1-3/h2-3,8-9H,4-7H2,1H3;1H,(H,2,3) |
| InChIKey | GRUZULLEVSCQID-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.23 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5,8-dichloro-3-[(1-methylpyrrolidin-3-yl)methyl]quinazolin-4-one;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,8-dichloro-3-[(1-methylpyrrolidin-3-yl)methyl]quinazolin-4-one;formic acid?
The IUPAC name of 5,8-dichloro-3-[(1-methylpyrrolidin-3-yl)methyl]quinazolin-4-one;formic acid (CID 154908704) is 5,8-dichloro-3-[(1-methylpyrrolidin-3-yl)methyl]quinazolin-4-one;formic acid.
What is the SMILES notation for 5,8-dichloro-3-[(1-methylpyrrolidin-3-yl)methyl]quinazolin-4-one;formic acid?
The canonical SMILES for 5,8-dichloro-3-[(1-methylpyrrolidin-3-yl)methyl]quinazolin-4-one;formic acid is CN1CCC(Cn2cnc3c(Cl)ccc(Cl)c3c2=O)C1.O=CO.
What is the InChIKey of 5,8-dichloro-3-[(1-methylpyrrolidin-3-yl)methyl]quinazolin-4-one;formic acid?
The InChIKey is GRUZULLEVSCQID-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15Cl2N3O.CH2O2/c1-18-5-4-9(6-18)7-19-8-17-13-11(16)3-2-10(15)12(13)14(19)20;2-1-3/h2-3,8-9H,4-7H2,1H3;1H,(H,2,3).
What are the key properties of 5,8-dichloro-3-[(1-methylpyrrolidin-3-yl)methyl]quinazolin-4-one;formic acid?
5,8-dichloro-3-[(1-methylpyrrolidin-3-yl)methyl]quinazolin-4-one;formic acid has a molecular weight of 358.23 g/mol, XLogP of 2.36, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,8-dichloro-3-[(1-methylpyrrolidin-3-yl)methyl]quinazolin-4-one;formic acid is sourced from PubChem (CID 154908704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).