C15H17Cl2N3O3 — CID 154908704
5,8-dichloro-3-[(1-methylpyrrolidin-3-yl)methyl]quinazolin-4-one;formic acid (PubChem CID 154908704) has the molecular formula C15H17Cl2N3O3 and a molecular weight of 358.23 g/mol. Its IUPAC name is 5,8-dichloro-3-[(1-methylpyrrolidin-3-yl)methyl]quinazolin-4-one;formic acid.
| Compound Name | 5,8-dichloro-3-[(1-methylpyrrolidin-3-yl)methyl]quinazolin-4-one;formic acid |
|---|---|
| PubChem CID | 154908704 |
| Molecular Formula | C15H17Cl2N3O3 |
| Molecular Weight | 358.23 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 5,8-dichloro-3-[(1-methylpyrrolidin-3-yl)methyl]quinazolin-4-one;formic acid |
| SMILES | CN1CCC(Cn2cnc3c(Cl)ccc(Cl)c3c2=O)C1.O=CO |
| InChI | InChI=1S/C14H15Cl2N3O.CH2O2/c1-18-5-4-9(6-18)7-19-8-17-13-11(16)3-2-10(15)12(13)14(19)20;2-1-3/h2-3,8-9H,4-7H2,1H3;1H,(H,2,3) |
| InChIKey | GRUZULLEVSCQID-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.23 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|