C16H26N4O4 — CID 154909057
4,6-dimethoxy-N-[[1-(pyrrolidin-1-ylmethyl)cyclopropyl]methyl]pyrimidin-2-amine;formic acid (PubChem CID 154909057) has the molecular formula C16H26N4O4 and a molecular weight of 338.41 g/mol. Its IUPAC name is 4,6-dimethoxy-N-[[1-(pyrrolidin-1-ylmethyl)cyclopropyl]methyl]pyrimidin-2-amine;formic acid.
| Compound Name | 4,6-dimethoxy-N-[[1-(pyrrolidin-1-ylmethyl)cyclopropyl]methyl]pyrimidin-2-amine;formic acid |
|---|---|
| PubChem CID | 154909057 |
| Molecular Formula | C16H26N4O4 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 4,6-dimethoxy-N-[[1-(pyrrolidin-1-ylmethyl)cyclopropyl]methyl]pyrimidin-2-amine;formic acid |
| SMILES | COc1cc(OC)nc(NCC2(CN3CCCC3)CC2)n1.O=CO |
| InChI | InChI=1S/C15H24N4O2.CH2O2/c1-20-12-9-13(21-2)18-14(17-12)16-10-15(5-6-15)11-19-7-3-4-8-19;2-1-3/h9H,3-8,10-11H2,1-2H3,(H,16,17,18);1H,(H,2,3) |
| InChIKey | OKYHRQGIABWWAL-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 96.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|