About formic acid;N-methyl-4-(4-methylpiperazin-1-yl)-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pentanamide
formic acid;N-methyl-4-(4-methylpiperazin-1-yl)-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pentanamide (PubChem CID 154909106) has the molecular formula C16H30N6O3
and a molecular weight of 354.46 g/mol. Its IUPAC name is formic acid;N-methyl-4-(4-methylpiperazin-1-yl)-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pentanamide.
Molecular Properties
| Compound Name | formic acid;N-methyl-4-(4-methylpiperazin-1-yl)-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pentanamide |
| PubChem CID | 154909106 |
| Molecular Formula | C16H30N6O3 |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | formic acid;N-methyl-4-(4-methylpiperazin-1-yl)-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pentanamide |
| SMILES | CC(CCC(=O)N(C)Cc1nncn1C)N1CCN(C)CC1.O=CO |
| InChI | InChI=1S/C15H28N6O.CH2O2/c1-13(21-9-7-18(2)8-10-21)5-6-15(22)19(3)11-14-17-16-12-20(14)4;2-1-3/h12-13H,5-11H2,1-4H3;1H,(H,2,3) |
| InChIKey | QCBDHINBZJDHPG-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 94.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze formic acid;N-methyl-4-(4-methylpiperazin-1-yl)-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formic acid;N-methyl-4-(4-methylpiperazin-1-yl)-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pentanamide?
The IUPAC name of formic acid;N-methyl-4-(4-methylpiperazin-1-yl)-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pentanamide (CID 154909106) is formic acid;N-methyl-4-(4-methylpiperazin-1-yl)-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pentanamide.
What is the SMILES notation for formic acid;N-methyl-4-(4-methylpiperazin-1-yl)-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pentanamide?
The canonical SMILES for formic acid;N-methyl-4-(4-methylpiperazin-1-yl)-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pentanamide is CC(CCC(=O)N(C)Cc1nncn1C)N1CCN(C)CC1.O=CO.
What is the InChIKey of formic acid;N-methyl-4-(4-methylpiperazin-1-yl)-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pentanamide?
The InChIKey is QCBDHINBZJDHPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N6O.CH2O2/c1-13(21-9-7-18(2)8-10-21)5-6-15(22)19(3)11-14-17-16-12-20(14)4;2-1-3/h12-13H,5-11H2,1-4H3;1H,(H,2,3).
What are the key properties of formic acid;N-methyl-4-(4-methylpiperazin-1-yl)-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pentanamide?
formic acid;N-methyl-4-(4-methylpiperazin-1-yl)-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pentanamide has a molecular weight of 354.46 g/mol, XLogP of -0.11, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for formic acid;N-methyl-4-(4-methylpiperazin-1-yl)-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pentanamide is sourced from PubChem (CID 154909106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).