C14H21N5O3S — CID 154909135
2-(dimethylamino)-8-(1,3-thiazol-5-ylmethyl)-1,3,8-triazaspiro[4.5]dec-1-en-4-one;formic acid (PubChem CID 154909135) has the molecular formula C14H21N5O3S and a molecular weight of 339.42 g/mol. Its IUPAC name is 2-(dimethylamino)-8-(1,3-thiazol-5-ylmethyl)-1,3,8-triazaspiro[4.5]dec-1-en-4-one;formic acid.
| Compound Name | 2-(dimethylamino)-8-(1,3-thiazol-5-ylmethyl)-1,3,8-triazaspiro[4.5]dec-1-en-4-one;formic acid |
|---|---|
| PubChem CID | 154909135 |
| Molecular Formula | C14H21N5O3S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 2-(dimethylamino)-8-(1,3-thiazol-5-ylmethyl)-1,3,8-triazaspiro[4.5]dec-1-en-4-one;formic acid |
| SMILES | CN(C)C1=NC2(CCN(Cc3cncs3)CC2)C(=O)N1.O=CO |
| InChI | InChI=1S/C13H19N5OS.CH2O2/c1-17(2)12-15-11(19)13(16-12)3-5-18(6-4-13)8-10-7-14-9-20-10;2-1-3/h7,9H,3-6,8H2,1-2H3,(H,15,16,19);1H,(H,2,3) |
| InChIKey | STROCAHBDJRLKV-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|