C15H28N4O5 — CID 154909175
N,N-dimethyl-4-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]morpholine-2-carboxamide;formic acid (PubChem CID 154909175) has the molecular formula C15H28N4O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is N,N-dimethyl-4-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]morpholine-2-carboxamide;formic acid.
| Compound Name | N,N-dimethyl-4-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]morpholine-2-carboxamide;formic acid |
|---|---|
| PubChem CID | 154909175 |
| Molecular Formula | C15H28N4O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | N,N-dimethyl-4-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]morpholine-2-carboxamide;formic acid |
| SMILES | CN1CCN(C(=O)CN2CCOC(C(=O)N(C)C)C2)CC1.O=CO |
| InChI | InChI=1S/C14H26N4O3.CH2O2/c1-15(2)14(20)12-10-17(8-9-21-12)11-13(19)18-6-4-16(3)5-7-18;2-1-3/h12H,4-11H2,1-3H3;1H,(H,2,3) |
| InChIKey | VSVNBAGBSLYFBG-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 93.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|