C18H28N2O4 — CID 154909390
2-ethoxy-N,2-dimethyl-N-[(2-methyl-1,3-dihydroisoindol-5-yl)methyl]propanamide;formic acid (PubChem CID 154909390) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is 2-ethoxy-N,2-dimethyl-N-[(2-methyl-1,3-dihydroisoindol-5-yl)methyl]propanamide;formic acid.
| Compound Name | 2-ethoxy-N,2-dimethyl-N-[(2-methyl-1,3-dihydroisoindol-5-yl)methyl]propanamide;formic acid |
|---|---|
| PubChem CID | 154909390 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 2-ethoxy-N,2-dimethyl-N-[(2-methyl-1,3-dihydroisoindol-5-yl)methyl]propanamide;formic acid |
| SMILES | CCOC(C)(C)C(=O)N(C)Cc1ccc2c(c1)CN(C)C2.O=CO |
| InChI | InChI=1S/C17H26N2O2.CH2O2/c1-6-21-17(2,3)16(20)19(5)10-13-7-8-14-11-18(4)12-15(14)9-13;2-1-3/h7-9H,6,10-12H2,1-5H3;1H,(H,2,3) |
| InChIKey | SGMJSHOYFJBROO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|