C18H29N3O5 — CID 154909433
formic acid;3-[[4-(2-methoxyethoxy)phenyl]methyl]-1-methyl-1-(1-methylpyrrolidin-3-yl)urea (PubChem CID 154909433) has the molecular formula C18H29N3O5 and a molecular weight of 367.45 g/mol. Its IUPAC name is formic acid;3-[[4-(2-methoxyethoxy)phenyl]methyl]-1-methyl-1-(1-methylpyrrolidin-3-yl)urea.
| Compound Name | formic acid;3-[[4-(2-methoxyethoxy)phenyl]methyl]-1-methyl-1-(1-methylpyrrolidin-3-yl)urea |
|---|---|
| PubChem CID | 154909433 |
| Molecular Formula | C18H29N3O5 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | formic acid;3-[[4-(2-methoxyethoxy)phenyl]methyl]-1-methyl-1-(1-methylpyrrolidin-3-yl)urea |
| SMILES | COCCOc1ccc(CNC(=O)N(C)C2CCN(C)C2)cc1.O=CO |
| InChI | InChI=1S/C17H27N3O3.CH2O2/c1-19-9-8-15(13-19)20(2)17(21)18-12-14-4-6-16(7-5-14)23-11-10-22-3;2-1-3/h4-7,15H,8-13H2,1-3H3,(H,18,21);1H,(H,2,3) |
| InChIKey | XJHUXZSTZHLOPW-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|