C14H24N4O4 — CID 154909512
formic acid;N,3,5-trimethyl-N-(2-morpholin-4-ylethyl)imidazole-4-carboxamide (PubChem CID 154909512) has the molecular formula C14H24N4O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is formic acid;N,3,5-trimethyl-N-(2-morpholin-4-ylethyl)imidazole-4-carboxamide.
| Compound Name | formic acid;N,3,5-trimethyl-N-(2-morpholin-4-ylethyl)imidazole-4-carboxamide |
|---|---|
| PubChem CID | 154909512 |
| Molecular Formula | C14H24N4O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | formic acid;N,3,5-trimethyl-N-(2-morpholin-4-ylethyl)imidazole-4-carboxamide |
| SMILES | Cc1ncn(C)c1C(=O)N(C)CCN1CCOCC1.O=CO |
| InChI | InChI=1S/C13H22N4O2.CH2O2/c1-11-12(16(3)10-14-11)13(18)15(2)4-5-17-6-8-19-9-7-17;2-1-3/h10H,4-9H2,1-3H3;1H,(H,2,3) |
| InChIKey | WJSIZNDXJPRWOG-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|