C19H35N3O7S — CID 154909532
[1-(1,1-dioxothiolan-3-yl)piperidin-4-yl]-(3,3,4-trimethylpiperazin-1-yl)methanone;formic acid (PubChem CID 154909532) has the molecular formula C19H35N3O7S and a molecular weight of 449.57 g/mol. Its IUPAC name is [1-(1,1-dioxothiolan-3-yl)piperidin-4-yl]-(3,3,4-trimethylpiperazin-1-yl)methanone;formic acid.
| Compound Name | [1-(1,1-dioxothiolan-3-yl)piperidin-4-yl]-(3,3,4-trimethylpiperazin-1-yl)methanone;formic acid |
|---|---|
| PubChem CID | 154909532 |
| Molecular Formula | C19H35N3O7S |
| Molecular Weight | 449.57 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | [1-(1,1-dioxothiolan-3-yl)piperidin-4-yl]-(3,3,4-trimethylpiperazin-1-yl)methanone;formic acid |
| SMILES | CN1CCN(C(=O)C2CCN(C3CCS(=O)(=O)C3)CC2)CC1(C)C.O=CO.O=CO |
| InChI | InChI=1S/C17H31N3O3S.2CH2O2/c1-17(2)13-20(10-9-18(17)3)16(21)14-4-7-19(8-5-14)15-6-11-24(22,23)12-15;2*2-1-3/h14-15H,4-13H2,1-3H3;2*1H,(H,2,3) |
| InChIKey | NMLLTYZAGZYREK-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 135.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.57 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|