C23H24ClN3O2 — CID 15490963
3-chloro-4-[4-(5-pyridin-2-yl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1,4-benzoxazepin-5-one (PubChem CID 15490963) has the molecular formula C23H24ClN3O2 and a molecular weight of 409.92 g/mol. Its IUPAC name is 3-chloro-4-[4-(5-pyridin-2-yl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1,4-benzoxazepin-5-one.
| Compound Name | 3-chloro-4-[4-(5-pyridin-2-yl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1,4-benzoxazepin-5-one |
|---|---|
| PubChem CID | 15490963 |
| Molecular Formula | C23H24ClN3O2 |
| Molecular Weight | 409.92 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 3-chloro-4-[4-(5-pyridin-2-yl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1,4-benzoxazepin-5-one |
| SMILES | O=C1c2ccccc2OC=C(Cl)N1CCCCN1CCC=C(c2ccccn2)C1 |
| InChI | InChI=1S/C23H24ClN3O2/c24-22-17-29-21-11-2-1-9-19(21)23(28)27(22)15-6-5-13-26-14-7-8-18(16-26)20-10-3-4-12-25-20/h1-4,8-12,17H,5-7,13-16H2 |
| InChIKey | CRMNDEKSAFBCHT-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.92 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|