C25H39N3O6 — CID 154909647
N-[1-(3,4-dihydro-1H-isoquinolin-2-yl)propan-2-yl]-1-(oxan-4-yl)piperidine-4-carboxamide;formic acid (PubChem CID 154909647) has the molecular formula C25H39N3O6 and a molecular weight of 477.60 g/mol. Its IUPAC name is N-[1-(3,4-dihydro-1H-isoquinolin-2-yl)propan-2-yl]-1-(oxan-4-yl)piperidine-4-carboxamide;formic acid.
| Compound Name | N-[1-(3,4-dihydro-1H-isoquinolin-2-yl)propan-2-yl]-1-(oxan-4-yl)piperidine-4-carboxamide;formic acid |
|---|---|
| PubChem CID | 154909647 |
| Molecular Formula | C25H39N3O6 |
| Molecular Weight | 477.60 g/mol |
| Exact Mass | 477.28 |
| IUPAC Name | N-[1-(3,4-dihydro-1H-isoquinolin-2-yl)propan-2-yl]-1-(oxan-4-yl)piperidine-4-carboxamide;formic acid |
| SMILES | CC(CN1CCc2ccccc2C1)NC(=O)C1CCN(C2CCOCC2)CC1.O=CO.O=CO |
| InChI | InChI=1S/C23H35N3O2.2CH2O2/c1-18(16-25-11-6-19-4-2-3-5-21(19)17-25)24-23(27)20-7-12-26(13-8-20)22-9-14-28-15-10-22;2*2-1-3/h2-5,18,20,22H,6-17H2,1H3,(H,24,27);2*1H,(H,2,3) |
| InChIKey | OTFAFPVDLIRKLA-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 119.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.60 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|