About 6-phenyl-3-[(3S)-pyrrolidin-3-yl]thieno[2,3-d]pyrimidin-4-one;hydrochloride
6-phenyl-3-[(3S)-pyrrolidin-3-yl]thieno[2,3-d]pyrimidin-4-one;hydrochloride (PubChem CID 154909653) has the molecular formula C16H16ClN3OS
and a molecular weight of 333.84 g/mol. Its IUPAC name is 6-phenyl-3-[(3S)-pyrrolidin-3-yl]thieno[2,3-d]pyrimidin-4-one;hydrochloride.
Molecular Properties
| Compound Name | 6-phenyl-3-[(3S)-pyrrolidin-3-yl]thieno[2,3-d]pyrimidin-4-one;hydrochloride |
| PubChem CID | 154909653 |
| Molecular Formula | C16H16ClN3OS |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 6-phenyl-3-[(3S)-pyrrolidin-3-yl]thieno[2,3-d]pyrimidin-4-one;hydrochloride |
| SMILES | Cl.O=c1c2cc(-c3ccccc3)sc2ncn1[C@H]1CCNC1 |
| InChI | InChI=1S/C16H15N3OS.ClH/c20-16-13-8-14(11-4-2-1-3-5-11)21-15(13)18-10-19(16)12-6-7-17-9-12;/h1-5,8,10,12,17H,6-7,9H2;1H/t12-;/m0./s1 |
| InChIKey | CYDDRIHZLTXPOD-YDALLXLXSA-N |
| XLogP | 3.08 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-phenyl-3-[(3S)-pyrrolidin-3-yl]thieno[2,3-d]pyrimidin-4-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-phenyl-3-[(3S)-pyrrolidin-3-yl]thieno[2,3-d]pyrimidin-4-one;hydrochloride?
The IUPAC name of 6-phenyl-3-[(3S)-pyrrolidin-3-yl]thieno[2,3-d]pyrimidin-4-one;hydrochloride (CID 154909653) is 6-phenyl-3-[(3S)-pyrrolidin-3-yl]thieno[2,3-d]pyrimidin-4-one;hydrochloride.
What is the SMILES notation for 6-phenyl-3-[(3S)-pyrrolidin-3-yl]thieno[2,3-d]pyrimidin-4-one;hydrochloride?
The canonical SMILES for 6-phenyl-3-[(3S)-pyrrolidin-3-yl]thieno[2,3-d]pyrimidin-4-one;hydrochloride is Cl.O=c1c2cc(-c3ccccc3)sc2ncn1[C@H]1CCNC1.
What is the InChIKey of 6-phenyl-3-[(3S)-pyrrolidin-3-yl]thieno[2,3-d]pyrimidin-4-one;hydrochloride?
The InChIKey is CYDDRIHZLTXPOD-YDALLXLXSA-N. The full InChI is InChI=1S/C16H15N3OS.ClH/c20-16-13-8-14(11-4-2-1-3-5-11)21-15(13)18-10-19(16)12-6-7-17-9-12;/h1-5,8,10,12,17H,6-7,9H2;1H/t12-;/m0./s1.
What are the key properties of 6-phenyl-3-[(3S)-pyrrolidin-3-yl]thieno[2,3-d]pyrimidin-4-one;hydrochloride?
6-phenyl-3-[(3S)-pyrrolidin-3-yl]thieno[2,3-d]pyrimidin-4-one;hydrochloride has a molecular weight of 333.84 g/mol, XLogP of 3.08, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phenyl-3-[(3S)-pyrrolidin-3-yl]thieno[2,3-d]pyrimidin-4-one;hydrochloride is sourced from PubChem (CID 154909653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).