C14H21N3O4 — CID 154909880
formic acid;1-(2-methyl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)-2-(oxolan-3-yl)ethanone (PubChem CID 154909880) has the molecular formula C14H21N3O4 and a molecular weight of 295.34 g/mol. Its IUPAC name is formic acid;1-(2-methyl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)-2-(oxolan-3-yl)ethanone.
| Compound Name | formic acid;1-(2-methyl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)-2-(oxolan-3-yl)ethanone |
|---|---|
| PubChem CID | 154909880 |
| Molecular Formula | C14H21N3O4 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | formic acid;1-(2-methyl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)-2-(oxolan-3-yl)ethanone |
| SMILES | Cc1nc2c([nH]1)CN(C(=O)CC1CCOC1)CC2.O=CO |
| InChI | InChI=1S/C13H19N3O2.CH2O2/c1-9-14-11-2-4-16(7-12(11)15-9)13(17)6-10-3-5-18-8-10;2-1-3/h10H,2-8H2,1H3,(H,14,15);1H,(H,2,3) |
| InChIKey | RNOWTXLTDHXOIG-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 95.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|