C15H27N3O2S2 — CID 154910023
N-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propyl]-N-methyl-1,4-dithiepan-6-amine;formic acid (PubChem CID 154910023) has the molecular formula C15H27N3O2S2 and a molecular weight of 345.53 g/mol. Its IUPAC name is N-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propyl]-N-methyl-1,4-dithiepan-6-amine;formic acid.
| Compound Name | N-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propyl]-N-methyl-1,4-dithiepan-6-amine;formic acid |
|---|---|
| PubChem CID | 154910023 |
| Molecular Formula | C15H27N3O2S2 |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | N-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propyl]-N-methyl-1,4-dithiepan-6-amine;formic acid |
| SMILES | Cc1n[nH]c(C)c1CCCN(C)C1CSCCSC1.O=CO |
| InChI | InChI=1S/C14H25N3S2.CH2O2/c1-11-14(12(2)16-15-11)5-4-6-17(3)13-9-18-7-8-19-10-13;2-1-3/h13H,4-10H2,1-3H3,(H,15,16);1H,(H,2,3) |
| InChIKey | MNRRZZCOTXILOR-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|