C15H26N4O3 — CID 154910174
N-[1-(diethylaminomethyl)cyclopropyl]-3-(1H-pyrazol-4-yl)propanamide;formic acid (PubChem CID 154910174) has the molecular formula C15H26N4O3 and a molecular weight of 310.40 g/mol. Its IUPAC name is N-[1-(diethylaminomethyl)cyclopropyl]-3-(1H-pyrazol-4-yl)propanamide;formic acid.
| Compound Name | N-[1-(diethylaminomethyl)cyclopropyl]-3-(1H-pyrazol-4-yl)propanamide;formic acid |
|---|---|
| PubChem CID | 154910174 |
| Molecular Formula | C15H26N4O3 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | N-[1-(diethylaminomethyl)cyclopropyl]-3-(1H-pyrazol-4-yl)propanamide;formic acid |
| SMILES | CCN(CC)CC1(NC(=O)CCc2cn[nH]c2)CC1.O=CO |
| InChI | InChI=1S/C14H24N4O.CH2O2/c1-3-18(4-2)11-14(7-8-14)17-13(19)6-5-12-9-15-16-10-12;2-1-3/h9-10H,3-8,11H2,1-2H3,(H,15,16)(H,17,19);1H,(H,2,3) |
| InChIKey | FBJZMBKPHNXJBD-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|