C12H21Cl2F3N2 — CID 154910177
(1S,2R,6S,7R)-10-(4,4,4-trifluorobutyl)-4,10-diazatricyclo[5.2.1.02,6]decane;dihydrochloride (PubChem CID 154910177) has the molecular formula C12H21Cl2F3N2 and a molecular weight of 321.21 g/mol. Its IUPAC name is (1S,2R,6S,7R)-10-(4,4,4-trifluorobutyl)-4,10-diazatricyclo[5.2.1.02,6]decane;dihydrochloride.
| Compound Name | (1S,2R,6S,7R)-10-(4,4,4-trifluorobutyl)-4,10-diazatricyclo[5.2.1.02,6]decane;dihydrochloride |
|---|---|
| PubChem CID | 154910177 |
| Molecular Formula | C12H21Cl2F3N2 |
| Molecular Weight | 321.21 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | (1S,2R,6S,7R)-10-(4,4,4-trifluorobutyl)-4,10-diazatricyclo[5.2.1.02,6]decane;dihydrochloride |
| SMILES | Cl.Cl.FC(F)(F)CCCN1[C@@H]2CC[C@H]1[C@H]1CNC[C@H]12 |
| InChI | InChI=1S/C12H19F3N2.2ClH/c13-12(14,15)4-1-5-17-10-2-3-11(17)9-7-16-6-8(9)10;;/h8-11,16H,1-7H2;2*1H/t8-,9+,10-,11+;; |
| InChIKey | VMCNNIIEAUDUQE-ZKFZZKMFSA-N |
| XLogP | 2.85 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.21 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |