C14H12ClF3N2O — CID 15491067
(4S)-6-chloro-4-(3-methylbut-1-ynyl)-4-(trifluoromethyl)-1,3-dihydroquinazolin-2-one (PubChem CID 15491067) has the molecular formula C14H12ClF3N2O and a molecular weight of 316.71 g/mol. Its IUPAC name is (4S)-6-chloro-4-(3-methylbut-1-ynyl)-4-(trifluoromethyl)-1,3-dihydroquinazolin-2-one.
| Compound Name | (4S)-6-chloro-4-(3-methylbut-1-ynyl)-4-(trifluoromethyl)-1,3-dihydroquinazolin-2-one |
|---|---|
| PubChem CID | 15491067 |
| Molecular Formula | C14H12ClF3N2O |
| Molecular Weight | 316.71 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | (4S)-6-chloro-4-(3-methylbut-1-ynyl)-4-(trifluoromethyl)-1,3-dihydroquinazolin-2-one |
| SMILES | CC(C)C#C[C@]1(C(F)(F)F)NC(=O)Nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C14H12ClF3N2O/c1-8(2)5-6-13(14(16,17)18)10-7-9(15)3-4-11(10)19-12(21)20-13/h3-4,7-8H,1-2H3,(H2,19,20,21)/t13-/m0/s1 |
| InChIKey | QBABWUINNOHOBD-ZDUSSCGKSA-N |
| XLogP | 3.89 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.71 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|