C14H21Cl2N5O2 — CID 154910700
2,5-dihydro-1H-pyrrol-2-yl-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]methanone;dihydrochloride (PubChem CID 154910700) has the molecular formula C14H21Cl2N5O2 and a molecular weight of 362.26 g/mol. Its IUPAC name is 2,5-dihydro-1H-pyrrol-2-yl-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]methanone;dihydrochloride.
| Compound Name | 2,5-dihydro-1H-pyrrol-2-yl-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 154910700 |
| Molecular Formula | C14H21Cl2N5O2 |
| Molecular Weight | 362.26 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 2,5-dihydro-1H-pyrrol-2-yl-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]methanone;dihydrochloride |
| SMILES | COc1ccnc(N2CCN(C(=O)C3C=CCN3)CC2)n1.Cl.Cl |
| InChI | InChI=1S/C14H19N5O2.2ClH/c1-21-12-4-6-16-14(17-12)19-9-7-18(8-10-19)13(20)11-3-2-5-15-11;;/h2-4,6,11,15H,5,7-10H2,1H3;2*1H |
| InChIKey | BOAGQPGASPYUQC-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.26 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|