C18H23ClN4O2 — CID 154910846
[(4aS,7aS)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-6-yl]-[3-(4-ethylphenyl)-1H-pyrazol-5-yl]methanone;hydrochloride (PubChem CID 154910846) has the molecular formula C18H23ClN4O2 and a molecular weight of 362.86 g/mol. Its IUPAC name is [(4aS,7aS)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-6-yl]-[3-(4-ethylphenyl)-1H-pyrazol-5-yl]methanone;hydrochloride.
| Compound Name | [(4aS,7aS)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-6-yl]-[3-(4-ethylphenyl)-1H-pyrazol-5-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 154910846 |
| Molecular Formula | C18H23ClN4O2 |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | [(4aS,7aS)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-6-yl]-[3-(4-ethylphenyl)-1H-pyrazol-5-yl]methanone;hydrochloride |
| SMILES | CCc1ccc(-c2cc(C(=O)N3C[C@@H]4NCCO[C@H]4C3)[nH]n2)cc1.Cl |
| InChI | InChI=1S/C18H22N4O2.ClH/c1-2-12-3-5-13(6-4-12)14-9-15(21-20-14)18(23)22-10-16-17(11-22)24-8-7-19-16;/h3-6,9,16-17,19H,2,7-8,10-11H2,1H3,(H,20,21);1H/t16-,17-;/m0./s1 |
| InChIKey | WFGJWXPWVPXNBT-QJHJCNPRSA-N |
| XLogP | 1.87 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |