C11H20ClN3O3S — CID 154911346
N-(2-pyrrolidin-1-ylsulfonylethyl)-2,5-dihydro-1H-pyrrole-2-carboxamide;hydrochloride (PubChem CID 154911346) has the molecular formula C11H20ClN3O3S and a molecular weight of 309.82 g/mol. Its IUPAC name is N-(2-pyrrolidin-1-ylsulfonylethyl)-2,5-dihydro-1H-pyrrole-2-carboxamide;hydrochloride.
| Compound Name | N-(2-pyrrolidin-1-ylsulfonylethyl)-2,5-dihydro-1H-pyrrole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 154911346 |
| Molecular Formula | C11H20ClN3O3S |
| Molecular Weight | 309.82 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | N-(2-pyrrolidin-1-ylsulfonylethyl)-2,5-dihydro-1H-pyrrole-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCCS(=O)(=O)N1CCCC1)C1C=CCN1 |
| InChI | InChI=1S/C11H19N3O3S.ClH/c15-11(10-4-3-5-12-10)13-6-9-18(16,17)14-7-1-2-8-14;/h3-4,10,12H,1-2,5-9H2,(H,13,15);1H |
| InChIKey | GJXRPBHKAPXICI-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.82 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|