C26H32ClN3O5 — CID 154911690
methyl (16S)-10,14-dioxospiro[2-oxa-11,15-diazatricyclo[16.2.2.13,7]tricosa-1(20),3,5,7(23),18,21-hexaene-9,4'-piperidine]-16-carboxylate;hydrochloride (PubChem CID 154911690) has the molecular formula C26H32ClN3O5 and a molecular weight of 502.01 g/mol. Its IUPAC name is methyl (16S)-10,14-dioxospiro[2-oxa-11,15-diazatricyclo[16.2.2.13,7]tricosa-1(20),3,5,7(23),18,21-hexaene-9,4'-piperidine]-16-carboxylate;hydrochloride.
| Compound Name | methyl (16S)-10,14-dioxospiro[2-oxa-11,15-diazatricyclo[16.2.2.13,7]tricosa-1(20),3,5,7(23),18,21-hexaene-9,4'-piperidine]-16-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 154911690 |
| Molecular Formula | C26H32ClN3O5 |
| Molecular Weight | 502.01 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | methyl (16S)-10,14-dioxospiro[2-oxa-11,15-diazatricyclo[16.2.2.13,7]tricosa-1(20),3,5,7(23),18,21-hexaene-9,4'-piperidine]-16-carboxylate;hydrochloride |
| SMILES | COC(=O)[C@@H]1Cc2ccc(cc2)Oc2cccc(c2)CC2(CCNCC2)C(=O)NCCC(=O)N1.Cl |
| InChI | InChI=1S/C26H31N3O5.ClH/c1-33-24(31)22-16-18-5-7-20(8-6-18)34-21-4-2-3-19(15-21)17-26(10-13-27-14-11-26)25(32)28-12-9-23(30)29-22;/h2-8,15,22,27H,9-14,16-17H2,1H3,(H,28,32)(H,29,30);1H/t22-;/m0./s1 |
| InChIKey | YVVSMBYBBNBLQS-FTBISJDPSA-N |
| XLogP | 2.53 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.01 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |