C23H34N4O5 — CID 154912354
N-[2-(1-ethylbenzimidazol-2-yl)ethyl]-1-pyrrolidin-1-ylcyclopentane-1-carboxamide;formic acid (PubChem CID 154912354) has the molecular formula C23H34N4O5 and a molecular weight of 446.55 g/mol. Its IUPAC name is N-[2-(1-ethylbenzimidazol-2-yl)ethyl]-1-pyrrolidin-1-ylcyclopentane-1-carboxamide;formic acid.
| Compound Name | N-[2-(1-ethylbenzimidazol-2-yl)ethyl]-1-pyrrolidin-1-ylcyclopentane-1-carboxamide;formic acid |
|---|---|
| PubChem CID | 154912354 |
| Molecular Formula | C23H34N4O5 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | N-[2-(1-ethylbenzimidazol-2-yl)ethyl]-1-pyrrolidin-1-ylcyclopentane-1-carboxamide;formic acid |
| SMILES | CCn1c(CCNC(=O)C2(N3CCCC3)CCCC2)nc2ccccc21.O=CO.O=CO |
| InChI | InChI=1S/C21H30N4O.2CH2O2/c1-2-25-18-10-4-3-9-17(18)23-19(25)11-14-22-20(26)21(12-5-6-13-21)24-15-7-8-16-24;2*2-1-3/h3-4,9-10H,2,5-8,11-16H2,1H3,(H,22,26);2*1H,(H,2,3) |
| InChIKey | GQKAGQZZOHVQNB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|