C18H33Cl2N3O — CID 154912377
(1S,2R,3S,4R)-3-amino-N-[3-(azepan-1-yl)propyl]-N-methylbicyclo[2.2.1]hept-5-ene-2-carboxamide;dihydrochloride (PubChem CID 154912377) has the molecular formula C18H33Cl2N3O and a molecular weight of 378.39 g/mol. Its IUPAC name is (1S,2R,3S,4R)-3-amino-N-[3-(azepan-1-yl)propyl]-N-methylbicyclo[2.2.1]hept-5-ene-2-carboxamide;dihydrochloride.
| Compound Name | (1S,2R,3S,4R)-3-amino-N-[3-(azepan-1-yl)propyl]-N-methylbicyclo[2.2.1]hept-5-ene-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 154912377 |
| Molecular Formula | C18H33Cl2N3O |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | (1S,2R,3S,4R)-3-amino-N-[3-(azepan-1-yl)propyl]-N-methylbicyclo[2.2.1]hept-5-ene-2-carboxamide;dihydrochloride |
| SMILES | CN(CCCN1CCCCCC1)C(=O)[C@H]1[C@@H](N)[C@H]2C=C[C@@H]1C2.Cl.Cl |
| InChI | InChI=1S/C18H31N3O.2ClH/c1-20(9-6-12-21-10-4-2-3-5-11-21)18(22)16-14-7-8-15(13-14)17(16)19;;/h7-8,14-17H,2-6,9-13,19H2,1H3;2*1H/t14-,15+,16-,17+;;/m1../s1 |
| InChIKey | ZVVKVZOHMKWTDE-BCAJUFOOSA-N |
| XLogP | 2.70 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|