C15H24Cl2N4O2 — CID 154912466
N-[3-[[2-(dimethylamino)acetyl]amino]phenyl]pyrrolidine-2-carboxamide;dihydrochloride (PubChem CID 154912466) has the molecular formula C15H24Cl2N4O2 and a molecular weight of 363.29 g/mol. Its IUPAC name is N-[3-[[2-(dimethylamino)acetyl]amino]phenyl]pyrrolidine-2-carboxamide;dihydrochloride.
| Compound Name | N-[3-[[2-(dimethylamino)acetyl]amino]phenyl]pyrrolidine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 154912466 |
| Molecular Formula | C15H24Cl2N4O2 |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | N-[3-[[2-(dimethylamino)acetyl]amino]phenyl]pyrrolidine-2-carboxamide;dihydrochloride |
| SMILES | CN(C)CC(=O)Nc1cccc(NC(=O)C2CCCN2)c1.Cl.Cl |
| InChI | InChI=1S/C15H22N4O2.2ClH/c1-19(2)10-14(20)17-11-5-3-6-12(9-11)18-15(21)13-7-4-8-16-13;;/h3,5-6,9,13,16H,4,7-8,10H2,1-2H3,(H,17,20)(H,18,21);2*1H |
| InChIKey | KKMWWFNSLSAKEL-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |