About 4-(2-tert-butylimidazol-1-yl)-2,2-diphenylbutanamide
4-(2-tert-butylimidazol-1-yl)-2,2-diphenylbutanamide (PubChem CID 15491327) has the molecular formula C23H27N3O
and a molecular weight of 361.49 g/mol. Its IUPAC name is 4-(2-tert-butylimidazol-1-yl)-2,2-diphenylbutanamide.
Molecular Properties
| Compound Name | 4-(2-tert-butylimidazol-1-yl)-2,2-diphenylbutanamide |
| PubChem CID | 15491327 |
| Molecular Formula | C23H27N3O |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | 4-(2-tert-butylimidazol-1-yl)-2,2-diphenylbutanamide |
| SMILES | CC(C)(C)c1nccn1CCC(C(N)=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H27N3O/c1-22(2,3)21-25-15-17-26(21)16-14-23(20(24)27,18-10-6-4-7-11-18)19-12-8-5-9-13-19/h4-13,15,17H,14,16H2,1-3H3,(H2,24,27) |
| InChIKey | KJZAMEYVYDSKPN-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-tert-butylimidazol-1-yl)-2,2-diphenylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-tert-butylimidazol-1-yl)-2,2-diphenylbutanamide?
The IUPAC name of 4-(2-tert-butylimidazol-1-yl)-2,2-diphenylbutanamide (CID 15491327) is 4-(2-tert-butylimidazol-1-yl)-2,2-diphenylbutanamide.
What is the SMILES notation for 4-(2-tert-butylimidazol-1-yl)-2,2-diphenylbutanamide?
The canonical SMILES for 4-(2-tert-butylimidazol-1-yl)-2,2-diphenylbutanamide is CC(C)(C)c1nccn1CCC(C(N)=O)(c1ccccc1)c1ccccc1.
What is the InChIKey of 4-(2-tert-butylimidazol-1-yl)-2,2-diphenylbutanamide?
The InChIKey is KJZAMEYVYDSKPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27N3O/c1-22(2,3)21-25-15-17-26(21)16-14-23(20(24)27,18-10-6-4-7-11-18)19-12-8-5-9-13-19/h4-13,15,17H,14,16H2,1-3H3,(H2,24,27).
What are the key properties of 4-(2-tert-butylimidazol-1-yl)-2,2-diphenylbutanamide?
4-(2-tert-butylimidazol-1-yl)-2,2-diphenylbutanamide has a molecular weight of 361.49 g/mol, XLogP of 4.04, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-tert-butylimidazol-1-yl)-2,2-diphenylbutanamide is sourced from PubChem (CID 15491327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).