About formic acid;3-(4-methylsulfonylpiperazin-1-yl)-1,2-benzothiazole
formic acid;3-(4-methylsulfonylpiperazin-1-yl)-1,2-benzothiazole (PubChem CID 154913391) has the molecular formula C13H17N3O4S2
and a molecular weight of 343.43 g/mol. Its IUPAC name is formic acid;3-(4-methylsulfonylpiperazin-1-yl)-1,2-benzothiazole.
Molecular Properties
| Compound Name | formic acid;3-(4-methylsulfonylpiperazin-1-yl)-1,2-benzothiazole |
| PubChem CID | 154913391 |
| Molecular Formula | C13H17N3O4S2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | formic acid;3-(4-methylsulfonylpiperazin-1-yl)-1,2-benzothiazole |
| SMILES | CS(=O)(=O)N1CCN(c2nsc3ccccc23)CC1.O=CO |
| InChI | InChI=1S/C12H15N3O2S2.CH2O2/c1-19(16,17)15-8-6-14(7-9-15)12-10-4-2-3-5-11(10)18-13-12;2-1-3/h2-5H,6-9H2,1H3;1H,(H,2,3) |
| InChIKey | XPFCTVWUVCHEPR-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 90.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze formic acid;3-(4-methylsulfonylpiperazin-1-yl)-1,2-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formic acid;3-(4-methylsulfonylpiperazin-1-yl)-1,2-benzothiazole?
The IUPAC name of formic acid;3-(4-methylsulfonylpiperazin-1-yl)-1,2-benzothiazole (CID 154913391) is formic acid;3-(4-methylsulfonylpiperazin-1-yl)-1,2-benzothiazole.
What is the SMILES notation for formic acid;3-(4-methylsulfonylpiperazin-1-yl)-1,2-benzothiazole?
The canonical SMILES for formic acid;3-(4-methylsulfonylpiperazin-1-yl)-1,2-benzothiazole is CS(=O)(=O)N1CCN(c2nsc3ccccc23)CC1.O=CO.
What is the InChIKey of formic acid;3-(4-methylsulfonylpiperazin-1-yl)-1,2-benzothiazole?
The InChIKey is XPFCTVWUVCHEPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O2S2.CH2O2/c1-19(16,17)15-8-6-14(7-9-15)12-10-4-2-3-5-11(10)18-13-12;2-1-3/h2-5H,6-9H2,1H3;1H,(H,2,3).
What are the key properties of formic acid;3-(4-methylsulfonylpiperazin-1-yl)-1,2-benzothiazole?
formic acid;3-(4-methylsulfonylpiperazin-1-yl)-1,2-benzothiazole has a molecular weight of 343.43 g/mol, XLogP of 1.08, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for formic acid;3-(4-methylsulfonylpiperazin-1-yl)-1,2-benzothiazole is sourced from PubChem (CID 154913391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).