C16H21N3O4S — CID 154913459
2-(5-acetylthiophen-3-yl)-N-[(1-ethylimidazol-2-yl)methyl]-N-methylacetamide;formic acid (PubChem CID 154913459) has the molecular formula C16H21N3O4S and a molecular weight of 351.43 g/mol. Its IUPAC name is 2-(5-acetylthiophen-3-yl)-N-[(1-ethylimidazol-2-yl)methyl]-N-methylacetamide;formic acid.
| Compound Name | 2-(5-acetylthiophen-3-yl)-N-[(1-ethylimidazol-2-yl)methyl]-N-methylacetamide;formic acid |
|---|---|
| PubChem CID | 154913459 |
| Molecular Formula | C16H21N3O4S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 2-(5-acetylthiophen-3-yl)-N-[(1-ethylimidazol-2-yl)methyl]-N-methylacetamide;formic acid |
| SMILES | CCn1ccnc1CN(C)C(=O)Cc1csc(C(C)=O)c1.O=CO |
| InChI | InChI=1S/C15H19N3O2S.CH2O2/c1-4-18-6-5-16-14(18)9-17(3)15(20)8-12-7-13(11(2)19)21-10-12;2-1-3/h5-7,10H,4,8-9H2,1-3H3;1H,(H,2,3) |
| InChIKey | LVSOOBDWLWUREK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|