C21H34N6O6 — CID 154913462
4-(3-carbamoyl-2-pyridinyl)-N-(3-piperidin-1-ylpropyl)piperazine-1-carboxamide;formic acid (PubChem CID 154913462) has the molecular formula C21H34N6O6 and a molecular weight of 466.54 g/mol. Its IUPAC name is 4-(3-carbamoyl-2-pyridinyl)-N-(3-piperidin-1-ylpropyl)piperazine-1-carboxamide;formic acid.
| Compound Name | 4-(3-carbamoyl-2-pyridinyl)-N-(3-piperidin-1-ylpropyl)piperazine-1-carboxamide;formic acid |
|---|---|
| PubChem CID | 154913462 |
| Molecular Formula | C21H34N6O6 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | 4-(3-carbamoyl-2-pyridinyl)-N-(3-piperidin-1-ylpropyl)piperazine-1-carboxamide;formic acid |
| SMILES | NC(=O)c1cccnc1N1CCN(C(=O)NCCCN2CCCCC2)CC1.O=CO.O=CO |
| InChI | InChI=1S/C19H30N6O2.2CH2O2/c20-17(26)16-6-4-7-21-18(16)24-12-14-25(15-13-24)19(27)22-8-5-11-23-9-2-1-3-10-23;2*2-1-3/h4,6-7H,1-3,5,8-15H2,(H2,20,26)(H,22,27);2*1H,(H,2,3) |
| InChIKey | PUXXTGXIDYLPKW-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 169.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|